C19H40O3Si — CID 57326345
tert-butyl-[(4S,6S)-6-(methoxymethoxy)undec-1-en-4-yl]oxy-dimethylsilane (PubChem CID 57326345) has the molecular formula C19H40O3Si and a molecular weight of 344.61 g/mol. Its IUPAC name is tert-butyl-[(4S,6S)-6-(methoxymethoxy)undec-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,6S)-6-(methoxymethoxy)undec-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 57326345 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | tert-butyl-[(4S,6S)-6-(methoxymethoxy)undec-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](C[C@H](CCCCC)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si/c1-9-11-12-14-17(21-16-20-6)15-18(13-10-2)22-23(7,8)19(3,4)5/h10,17-18H,2,9,11-16H2,1,3-8H3/t17-,18-/m0/s1 |
| InChIKey | PPMYGYDLXOBWFH-ROUUACIJSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|