About 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride
3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride (PubChem CID 57326400) has the molecular formula C24H19ClN4S
and a molecular weight of 430.96 g/mol. Its IUPAC name is 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride.
Molecular Properties
| Compound Name | 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride |
| PubChem CID | 57326400 |
| Molecular Formula | C24H19ClN4S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride |
| SMILES | Cl.c1ccc(-n2s/c(=N\Cc3cccnc3)nc2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H18N4S.ClH/c1-2-11-20(12-3-1)28-23(22-14-6-10-19-9-4-5-13-21(19)22)27-24(29-28)26-17-18-8-7-15-25-16-18;/h1-16H,17H2;1H/b26-24-; |
| InChIKey | WQJOKNQGUVAJAD-FSKGQQLBSA-N |
| XLogP | 5.67 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|
Analyze 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride?
The IUPAC name of 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride (CID 57326400) is 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride.
What is the SMILES notation for 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride?
The canonical SMILES for 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride is Cl.c1ccc(-n2s/c(=N\Cc3cccnc3)nc2-c2cccc3ccccc23)cc1.
What is the InChIKey of 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride?
The InChIKey is WQJOKNQGUVAJAD-FSKGQQLBSA-N. The full InChI is InChI=1S/C24H18N4S.ClH/c1-2-11-20(12-3-1)28-23(22-14-6-10-19-9-4-5-13-21(19)22)27-24(29-28)26-17-18-8-7-15-25-16-18;/h1-16H,17H2;1H/b26-24-;.
What are the key properties of 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride?
3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride has a molecular weight of 430.96 g/mol, XLogP of 5.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-1-yl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrochloride is sourced from PubChem (CID 57326400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).