C18H36O4Si — CID 57326433
(E,5S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxydodec-6-enoic acid (PubChem CID 57326433) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (E,5S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxydodec-6-enoic acid.
| Compound Name | (E,5S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxydodec-6-enoic acid |
|---|---|
| PubChem CID | 57326433 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (E,5S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-9-hydroxydodec-6-enoic acid |
| SMILES | CCC[C@@H](O)C/C=C/[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-7-10-15(19)11-8-12-16(13-9-14-17(20)21)22-23(5,6)18(2,3)4/h8,12,15-16,19H,7,9-11,13-14H2,1-6H3,(H,20,21)/b12-8+/t15-,16-/m1/s1 |
| InChIKey | IGDROEDANIRCOE-SKYCBFMCSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|