C26H31N5O4 — CID 57326800
(3S)-N-benzyl-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 57326800) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is (3S)-N-benzyl-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-benzyl-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 57326800 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (3S)-N-benzyl-1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | COc1cc(Nc2nccc(N3CCC[C@H](C(=O)NCc4ccccc4)C3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N5O4/c1-33-21-14-20(15-22(34-2)24(21)35-3)29-26-27-12-11-23(30-26)31-13-7-10-19(17-31)25(32)28-16-18-8-5-4-6-9-18/h4-6,8-9,11-12,14-15,19H,7,10,13,16-17H2,1-3H3,(H,28,32)(H,27,29,30)/t19-/m0/s1 |
| InChIKey | GZASFQJHPYLYRJ-IBGZPJMESA-N |
| XLogP | 3.78 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |