C46H70O6Si2 — CID 57327143
ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-triethylsilyloxybutanoate (PubChem CID 57327143) has the molecular formula C46H70O6Si2 and a molecular weight of 775.23 g/mol. Its IUPAC name is ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-triethylsilyloxybutanoate.
| Compound Name | ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-triethylsilyloxybutanoate |
|---|---|
| PubChem CID | 57327143 |
| Molecular Formula | C46H70O6Si2 |
| Molecular Weight | 775.23 g/mol |
| Exact Mass | 774.47 |
| IUPAC Name | ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-triethylsilyloxybutanoate |
| SMILES | CCOC(=O)C[C@@H](C[C@@H]1O[C@H](C[C@H](CCOCc2ccccc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC1(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C46H70O6Si2/c1-10-49-44(47)35-40(51-53(11-2,12-3)13-4)34-43-46(8,9)31-29-38(50-43)33-39(30-32-48-36-37-23-17-14-18-24-37)52-54(45(5,6)7,41-25-19-15-20-26-41)42-27-21-16-22-28-42/h14-28,38-40,43H,10-13,29-36H2,1-9H3/t38-,39-,40+,43-/m0/s1 |
| InChIKey | RBTBPTXUTHPQFN-FIVMKYLISA-N |
| XLogP | 10.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.23 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|