C40H56O6Si — CID 57327157
ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-hydroxybutanoate (PubChem CID 57327157) has the molecular formula C40H56O6Si and a molecular weight of 660.97 g/mol. Its IUPAC name is ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-hydroxybutanoate.
| Compound Name | ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 57327157 |
| Molecular Formula | C40H56O6Si |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 660.38 |
| IUPAC Name | ethyl (3R)-4-[(2S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-3,3-dimethyloxan-2-yl]-3-hydroxybutanoate |
| SMILES | CCOC(=O)C[C@H](O)C[C@@H]1O[C@H](C[C@H](CCOCc2ccccc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C40H56O6Si/c1-7-44-38(42)28-32(41)27-37-40(5,6)25-23-33(45-37)29-34(24-26-43-30-31-17-11-8-12-18-31)46-47(39(2,3)4,35-19-13-9-14-20-35)36-21-15-10-16-22-36/h8-22,32-34,37,41H,7,23-30H2,1-6H3/t32-,33+,34+,37+/m1/s1 |
| InChIKey | MVCSVHLRJXHQSB-ZERKYRJWSA-N |
| XLogP | 7.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|