C42H70O5Si3 — CID 57327161
(3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid (PubChem CID 57327161) has the molecular formula C42H70O5Si3 and a molecular weight of 739.28 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid.
| Compound Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 57327161 |
| Molecular Formula | C42H70O5Si3 |
| Molecular Weight | 739.28 g/mol |
| Exact Mass | 738.45 |
| IUPAC Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butanoic acid |
| SMILES | C=C(C[C@@H](C[C@@H]1O[C@H](C[C@H](CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC1(C)C)O[Si](CC)(CC)CC)C[Si](C)(C)C |
| InChI | InChI=1S/C42H70O5Si3/c1-13-49(14-2,15-3)46-35(28-33(4)32-48(10,11)12)30-39-42(8,9)27-26-34(45-39)29-36(31-40(43)44)47-50(41(5,6)7,37-22-18-16-19-23-37)38-24-20-17-21-25-38/h16-25,34-36,39H,4,13-15,26-32H2,1-3,5-12H3,(H,43,44)/t34-,35-,36+,39-/m0/s1 |
| InChIKey | LRJDHYLADJZOID-UIHJCZHTSA-N |
| XLogP | 10.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.28 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|