C25H32O2S4 — CID 57327356
(2R,4S)-1,5-bis(2-phenyl-1,3-dithian-2-yl)pentane-2,4-diol (PubChem CID 57327356) has the molecular formula C25H32O2S4 and a molecular weight of 492.80 g/mol. Its IUPAC name is (2R,4S)-1,5-bis(2-phenyl-1,3-dithian-2-yl)pentane-2,4-diol.
| Compound Name | (2R,4S)-1,5-bis(2-phenyl-1,3-dithian-2-yl)pentane-2,4-diol |
|---|---|
| PubChem CID | 57327356 |
| Molecular Formula | C25H32O2S4 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | (2R,4S)-1,5-bis(2-phenyl-1,3-dithian-2-yl)pentane-2,4-diol |
| SMILES | O[C@H](C[C@H](O)CC1(c2ccccc2)SCCCS1)CC1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C25H32O2S4/c26-22(18-24(28-13-7-14-29-24)20-9-3-1-4-10-20)17-23(27)19-25(30-15-8-16-31-25)21-11-5-2-6-12-21/h1-6,9-12,22-23,26-27H,7-8,13-19H2/t22-,23+ |
| InChIKey | GHBHCBDTXAGCCO-ZRZAMGCNSA-N |
| XLogP | 6.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |