C27H28N4O6 — CID 57327512
ethyl 7-[3-(4-acetylpiperazin-1-yl)propoxy]-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate (PubChem CID 57327512) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is ethyl 7-[3-(4-acetylpiperazin-1-yl)propoxy]-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate.
| Compound Name | ethyl 7-[3-(4-acetylpiperazin-1-yl)propoxy]-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 57327512 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | ethyl 7-[3-(4-acetylpiperazin-1-yl)propoxy]-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
| SMILES | CCOC(=O)c1c2c(n3cccc(OCCCN4CCN(C(C)=O)CC4)c13)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C27H28N4O6/c1-3-36-27(35)21-20-24(26(34)22-18(25(20)33)7-4-9-28-22)31-11-5-8-19(23(21)31)37-16-6-10-29-12-14-30(15-13-29)17(2)32/h4-5,7-9,11H,3,6,10,12-16H2,1-2H3 |
| InChIKey | CYKFEYJPSIIOAU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 110.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|