C20H29NO3 — CID 57327673
(1R,3S,6S,7R,10S,11R)-3,12-dimethyl-7-(piperidin-1-ylmethyl)-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one (PubChem CID 57327673) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (1R,3S,6S,7R,10S,11R)-3,12-dimethyl-7-(piperidin-1-ylmethyl)-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one.
| Compound Name | (1R,3S,6S,7R,10S,11R)-3,12-dimethyl-7-(piperidin-1-ylmethyl)-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one |
|---|---|
| PubChem CID | 57327673 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (1R,3S,6S,7R,10S,11R)-3,12-dimethyl-7-(piperidin-1-ylmethyl)-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one |
| SMILES | CC1=CC[C@]23O[C@@]2(C)CC[C@@H]2[C@H](OC(=O)[C@H]2CN2CCCCC2)[C@@H]13 |
| InChI | InChI=1S/C20H29NO3/c1-13-6-9-20-16(13)17-14(7-8-19(20,2)24-20)15(18(22)23-17)12-21-10-4-3-5-11-21/h6,14-17H,3-5,7-12H2,1-2H3/t14-,15-,16+,17-,19-,20+/m0/s1 |
| InChIKey | UHXBZEWVMJPSLK-JMCXLBPQSA-N |
| XLogP | 2.92 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|