C23H27NO11Se — CID 57327697
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethoxy]oxan-2-yl]methyl acetate (PubChem CID 57327697) has the molecular formula C23H27NO11Se and a molecular weight of 572.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 57327697 |
| Molecular Formula | C23H27NO11Se |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCn2[se]c3ccccc3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H27NO11Se/c1-12(25)31-11-17-19(32-13(2)26)20(33-14(3)27)21(34-15(4)28)23(35-17)30-10-9-24-22(29)16-7-5-6-8-18(16)36-24/h5-8,17,19-21,23H,9-11H2,1-4H3/t17-,19-,20+,21-,23-/m1/s1 |
| InChIKey | CSMROVZZWSLUBA-OXUVVOBNSA-N |
| XLogP | 0.16 |
| TPSA | 145.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|