About 4-benzyl-3,5-dimethyl-1H-pyrazole
4-benzyl-3,5-dimethyl-1H-pyrazole (PubChem CID 573277) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-benzyl-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-benzyl-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 573277 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-benzyl-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1Cc1ccccc1 |
| InChI | InChI=1S/C12H14N2/c1-9-12(10(2)14-13-9)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,13,14) |
| InChIKey | DYXNQVLCTOFNRG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-benzyl-3,5-dimethyl-1H-pyrazole (CID 573277) is 4-benzyl-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-benzyl-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-benzyl-3,5-dimethyl-1H-pyrazole is Cc1n[nH]c(C)c1Cc1ccccc1.
What is the InChIKey of 4-benzyl-3,5-dimethyl-1H-pyrazole?
The InChIKey is DYXNQVLCTOFNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-9-12(10(2)14-13-9)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,13,14).
What are the key properties of 4-benzyl-3,5-dimethyl-1H-pyrazole?
4-benzyl-3,5-dimethyl-1H-pyrazole has a molecular weight of 186.26 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 573277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).