C15H19NO7Se — CID 57327765
2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,2-benzoselenazol-3-one (PubChem CID 57327765) has the molecular formula C15H19NO7Se and a molecular weight of 404.28 g/mol. Its IUPAC name is 2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,2-benzoselenazol-3-one.
| Compound Name | 2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 57327765 |
| Molecular Formula | C15H19NO7Se |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1CCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19NO7Se/c17-7-9-11(18)12(19)13(20)15(23-9)22-6-5-16-14(21)8-3-1-2-4-10(8)24-16/h1-4,9,11-13,15,17-20H,5-7H2/t9-,11-,12+,13-,15-/m1/s1 |
| InChIKey | XEFWWWWIYVEPQG-VWKSAYTASA-N |
| XLogP | -2.12 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|