C13H15NO6Se — CID 57327839
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2-benzoselenazol-3-one (PubChem CID 57327839) has the molecular formula C13H15NO6Se and a molecular weight of 360.22 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2-benzoselenazol-3-one.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 57327839 |
| Molecular Formula | C13H15NO6Se |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H15NO6Se/c15-5-7-9(16)10(17)11(18)13(20-7)14-12(19)6-3-1-2-4-8(6)21-14/h1-4,7,9-11,13,15-18H,5H2/t7-,9+,10+,11-,13-/m1/s1 |
| InChIKey | MMWJFDUOALSGTB-GWPLPQDCSA-N |
| XLogP | -1.97 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|