About 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole
4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole (PubChem CID 57327897) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole.
Analyze 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole?
The IUPAC name of 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole (CID 57327897) is 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole.
What is the SMILES notation for 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole?
The canonical SMILES for 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole is c1noc2c1CCCCCC2.
What is the InChIKey of 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole?
The InChIKey is LXUREFUCZXXTMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-4-6-9-8(5-3-1)7-10-11-9/h7H,1-6H2.
What are the key properties of 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole?
4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole has a molecular weight of 151.21 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7,8,9-hexahydrocycloocta[d][1,2]oxazole is sourced from PubChem (CID 57327897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).