C10H15N3 — CID 57327898
5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-amine (PubChem CID 57327898) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-amine.
| Compound Name | 5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 57327898 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-amine |
| SMILES | Nc1ncc2c(n1)CCCCCC2 |
| InChI | InChI=1S/C10H15N3/c11-10-12-7-8-5-3-1-2-4-6-9(8)13-10/h7H,1-6H2,(H2,11,12,13) |
| InChIKey | QAKWXEQPNIBLJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |