C18H19N3 — CID 57327899
5-phenyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene (PubChem CID 57327899) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-phenyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene.
| Compound Name | 5-phenyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 57327899 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 5-phenyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene |
| SMILES | c1ccc(-c2cnn3c4c(cnc23)CCCCCC4)cc1 |
| InChI | InChI=1S/C18H19N3/c1-2-7-11-17-15(10-4-1)12-19-18-16(13-20-21(17)18)14-8-5-3-6-9-14/h3,5-6,8-9,12-13H,1-2,4,7,10-11H2 |
| InChIKey | KZKYFNFWHDMEHA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |