C17H22N2O7Se — CID 57327913
4-(3-oxo-1,2-benzoselenazol-2-yl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanamide (PubChem CID 57327913) has the molecular formula C17H22N2O7Se and a molecular weight of 445.33 g/mol. Its IUPAC name is 4-(3-oxo-1,2-benzoselenazol-2-yl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanamide.
| Compound Name | 4-(3-oxo-1,2-benzoselenazol-2-yl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanamide |
|---|---|
| PubChem CID | 57327913 |
| Molecular Formula | C17H22N2O7Se |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 4-(3-oxo-1,2-benzoselenazol-2-yl)-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanamide |
| SMILES | O=C(CCCn1[se]c2ccccc2c1=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H22N2O7Se/c20-8-10-13(22)14(23)15(24)16(26-10)18-12(21)6-3-7-19-17(25)9-4-1-2-5-11(9)27-19/h1-2,4-5,10,13-16,20,22-24H,3,6-8H2,(H,18,21)/t10-,13-,14+,15-,16-/m1/s1 |
| InChIKey | URSLEHKVHAOWPQ-LMXXTMHSSA-N |
| XLogP | -2.25 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|