C17H17NO3 — CID 57328042
(6aS,12bR)-11-methyl-6a,7,8,12b-tetrahydro-6H-chromeno[3,4-c]isoquinoline-2,3-diol (PubChem CID 57328042) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (6aS,12bR)-11-methyl-6a,7,8,12b-tetrahydro-6H-chromeno[3,4-c]isoquinoline-2,3-diol.
| Compound Name | (6aS,12bR)-11-methyl-6a,7,8,12b-tetrahydro-6H-chromeno[3,4-c]isoquinoline-2,3-diol |
|---|---|
| PubChem CID | 57328042 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (6aS,12bR)-11-methyl-6a,7,8,12b-tetrahydro-6H-chromeno[3,4-c]isoquinoline-2,3-diol |
| SMILES | Cc1ccc2c(c1)[C@@H]1c3cc(O)c(O)cc3OC[C@H]1NC2 |
| InChI | InChI=1S/C17H17NO3/c1-9-2-3-10-7-18-13-8-21-16-6-15(20)14(19)5-12(16)17(13)11(10)4-9/h2-6,13,17-20H,7-8H2,1H3/t13-,17-/m1/s1 |
| InChIKey | LMCNYDDYNFCAGO-CXAGYDPISA-N |
| XLogP | 2.40 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|