C16H24N2O4 — CID 57328060
1-N,2-N-bis[(2R)-1-hydroxybutan-2-yl]benzene-1,2-dicarboxamide (PubChem CID 57328060) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-N,2-N-bis[(2R)-1-hydroxybutan-2-yl]benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[(2R)-1-hydroxybutan-2-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 57328060 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-N,2-N-bis[(2R)-1-hydroxybutan-2-yl]benzene-1,2-dicarboxamide |
| SMILES | CC[C@H](CO)NC(=O)c1ccccc1C(=O)N[C@H](CC)CO |
| InChI | InChI=1S/C16H24N2O4/c1-3-11(9-19)17-15(21)13-7-5-6-8-14(13)16(22)18-12(4-2)10-20/h5-8,11-12,19-20H,3-4,9-10H2,1-2H3,(H,17,21)(H,18,22)/t11-,12-/m1/s1 |
| InChIKey | IBSGUGQKWUGEIY-VXGBXAGGSA-N |
| XLogP | 0.69 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |