C18H23N3O3S — CID 57328394
5-methyl-3-phenyl-N-[5-[(2-sulfanylacetyl)amino]pentyl]-1,2-oxazole-4-carboxamide (PubChem CID 57328394) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 5-methyl-3-phenyl-N-[5-[(2-sulfanylacetyl)amino]pentyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-3-phenyl-N-[5-[(2-sulfanylacetyl)amino]pentyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 57328394 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-methyl-3-phenyl-N-[5-[(2-sulfanylacetyl)amino]pentyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)NCCCCCNC(=O)CS |
| InChI | InChI=1S/C18H23N3O3S/c1-13-16(17(21-24-13)14-8-4-2-5-9-14)18(23)20-11-7-3-6-10-19-15(22)12-25/h2,4-5,8-9,25H,3,6-7,10-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | WWLIISZAGFGMDE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|