C16H16ClNO2S — CID 57328413
(6aS,12bR)-6a,7,8,12b-tetrahydro-6H-thiochromeno[3,4-c]isoquinoline-2,3-diol;hydrochloride (PubChem CID 57328413) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is (6aS,12bR)-6a,7,8,12b-tetrahydro-6H-thiochromeno[3,4-c]isoquinoline-2,3-diol;hydrochloride.
| Compound Name | (6aS,12bR)-6a,7,8,12b-tetrahydro-6H-thiochromeno[3,4-c]isoquinoline-2,3-diol;hydrochloride |
|---|---|
| PubChem CID | 57328413 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (6aS,12bR)-6a,7,8,12b-tetrahydro-6H-thiochromeno[3,4-c]isoquinoline-2,3-diol;hydrochloride |
| SMILES | Cl.Oc1cc2c(cc1O)[C@H]1c3ccccc3CN[C@@H]1CS2 |
| InChI | InChI=1S/C16H15NO2S.ClH/c18-13-5-11-15(6-14(13)19)20-8-12-16(11)10-4-2-1-3-9(10)7-17-12;/h1-6,12,16-19H,7-8H2;1H/t12-,16-;/m1./s1 |
| InChIKey | RRUAXWZLEJZOET-VQZRABBESA-N |
| XLogP | 3.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|