C18H22FNO2 — CID 57328559
4-ethenyl-2-(4-fluorophenyl)-N-pentyl-2,5-dihydrofuran-3-carboxamide (PubChem CID 57328559) has the molecular formula C18H22FNO2 and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-ethenyl-2-(4-fluorophenyl)-N-pentyl-2,5-dihydrofuran-3-carboxamide.
| Compound Name | 4-ethenyl-2-(4-fluorophenyl)-N-pentyl-2,5-dihydrofuran-3-carboxamide |
|---|---|
| PubChem CID | 57328559 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-ethenyl-2-(4-fluorophenyl)-N-pentyl-2,5-dihydrofuran-3-carboxamide |
| SMILES | CCCCCNC(=O)C1=C(COC1C2=CC=C(C=C2)F)C=C |
| InChI | InChI=1S/C18H22FNO2/c1-3-5-6-11-20-18(21)16-13(4-2)12-22-17(16)14-7-9-15(19)10-8-14/h4,7-10,17H,2-3,5-6,11-12H2,1H3,(H,20,21) |
| InChIKey | BVIGRNOOGXQPTF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | 425 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|