C26H31NO5 — CID 57328615
5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide (PubChem CID 57328615) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide.
| Compound Name | 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 57328615 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2,4-dimethoxybenzamide |
| SMILES | COc1cc(OC)c(C23CC4CC(CC(C4)C2)C3)cc1C(=O)NCc1ccc(O)cc1O |
| InChI | InChI=1S/C26H31NO5/c1-31-23-10-24(32-2)21(26-11-15-5-16(12-26)7-17(6-15)13-26)9-20(23)25(30)27-14-18-3-4-19(28)8-22(18)29/h3-4,8-10,15-17,28-29H,5-7,11-14H2,1-2H3,(H,27,30) |
| InChIKey | WDLDXQVTSRCDMN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|