About 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide
5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide (PubChem CID 57328616) has the molecular formula C25H29NO5
and a molecular weight of 423.51 g/mol. Its IUPAC name is 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide.
Molecular Properties
| Compound Name | 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide |
| PubChem CID | 57328616 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1cc(O)c(C(=O)NCc2ccc(O)cc2O)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29NO5/c1-31-23-9-22(29)19(24(30)26-13-17-2-3-18(27)7-21(17)28)8-20(23)25-10-14-4-15(11-25)6-16(5-14)12-25/h2-3,7-9,14-16,27-29H,4-6,10-13H2,1H3,(H,26,30) |
| InChIKey | SQCLSKGGXIWWPU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide?
The IUPAC name of 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide (CID 57328616) is 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide.
What is the SMILES notation for 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide?
The canonical SMILES for 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide is COc1cc(O)c(C(=O)NCc2ccc(O)cc2O)cc1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide?
The InChIKey is SQCLSKGGXIWWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO5/c1-31-23-9-22(29)19(24(30)26-13-17-2-3-18(27)7-21(17)28)8-20(23)25-10-14-4-15(11-25)6-16(5-14)12-25/h2-3,7-9,14-16,27-29H,4-6,10-13H2,1H3,(H,26,30).
What are the key properties of 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide?
5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide has a molecular weight of 423.51 g/mol, XLogP of 4.21, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-2-hydroxy-4-methoxybenzamide is sourced from PubChem (CID 57328616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).