About 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol
4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol (PubChem CID 57328685) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol.
Molecular Properties
| Compound Name | 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol |
| PubChem CID | 57328685 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol |
| SMILES | OC[C@@H]1[C@@H](Cc2ccc(O)cc2)CO[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O4/c19-10-17-14(9-12-1-5-15(20)6-2-12)11-22-18(17)13-3-7-16(21)8-4-13/h1-8,14,17-21H,9-11H2/t14-,17+,18-/m0/s1 |
| InChIKey | VTBUYLULHBDANC-QGTPRVQTSA-N |
| XLogP | 2.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol?
The IUPAC name of 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol (CID 57328685) is 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol.
What is the SMILES notation for 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol?
The canonical SMILES for 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol is OC[C@@H]1[C@@H](Cc2ccc(O)cc2)CO[C@H]1c1ccc(O)cc1.
What is the InChIKey of 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol?
The InChIKey is VTBUYLULHBDANC-QGTPRVQTSA-N. The full InChI is InChI=1S/C18H20O4/c19-10-17-14(9-12-1-5-15(20)6-2-12)11-22-18(17)13-3-7-16(21)8-4-13/h1-8,14,17-21H,9-11H2/t14-,17+,18-/m0/s1.
What are the key properties of 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol?
4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol has a molecular weight of 300.35 g/mol, XLogP of 2.64, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R,4S,5R)-4-(hydroxymethyl)-5-(4-hydroxyphenyl)oxolan-3-yl]methyl]phenol is sourced from PubChem (CID 57328685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).