C18H13ClFN3OS — CID 57328869
2-[3-(2-chlorophenyl)pyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 57328869) has the molecular formula C18H13ClFN3OS and a molecular weight of 373.84 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)pyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[3-(2-chlorophenyl)pyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 57328869 |
| Molecular Formula | C18H13ClFN3OS |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-[3-(2-chlorophenyl)pyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CSc1nccnc1-c1ccccc1Cl)Nc1ccccc1F |
| InChI | InChI=1S/C18H13ClFN3OS/c19-13-6-2-1-5-12(13)17-18(22-10-9-21-17)25-11-16(24)23-15-8-4-3-7-14(15)20/h1-10H,11H2,(H,23,24) |
| InChIKey | PVMPSWZICURELW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |