About 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione
7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione (PubChem CID 57329448) has the molecular formula C17H14N2O4
and a molecular weight of 310.31 g/mol. Its IUPAC name is 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione.
Molecular Properties
| Compound Name | 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione |
| PubChem CID | 57329448 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione |
| SMILES | O=C1C=C(NCCc2ccc(O)c(O)c2)C(=O)c2ncccc21 |
| InChI | InChI=1S/C17H14N2O4/c20-13-4-3-10(8-15(13)22)5-7-18-12-9-14(21)11-2-1-6-19-16(11)17(12)23/h1-4,6,8-9,18,20,22H,5,7H2 |
| InChIKey | MRNXQPZAPRGMKF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione?
The IUPAC name of 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione (CID 57329448) is 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione.
What is the SMILES notation for 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione?
The canonical SMILES for 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione is O=C1C=C(NCCc2ccc(O)c(O)c2)C(=O)c2ncccc21.
What is the InChIKey of 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione?
The InChIKey is MRNXQPZAPRGMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c20-13-4-3-10(8-15(13)22)5-7-18-12-9-14(21)11-2-1-6-19-16(11)17(12)23/h1-4,6,8-9,18,20,22H,5,7H2.
What are the key properties of 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione?
7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione has a molecular weight of 310.31 g/mol, XLogP of 1.59, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(3,4-dihydroxyphenyl)ethylamino]quinoline-5,8-dione is sourced from PubChem (CID 57329448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).