About 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide
5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide (PubChem CID 57329522) has the molecular formula C16H21N5O3
and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide.
Molecular Properties
| Compound Name | 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide |
| PubChem CID | 57329522 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide |
| SMILES | CNC(=O)c1cc(Oc2cnc(N)nc2N)c(C(C)C)cc1OC |
| InChI | InChI=1S/C16H21N5O3/c1-8(2)9-5-11(23-4)10(15(22)19-3)6-12(9)24-13-7-20-16(18)21-14(13)17/h5-8H,1-4H3,(H,19,22)(H4,17,18,20,21) |
| InChIKey | VYJJKVHKWJBNBN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide?
The IUPAC name of 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide (CID 57329522) is 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide.
What is the SMILES notation for 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide?
The canonical SMILES for 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide is CNC(=O)c1cc(Oc2cnc(N)nc2N)c(C(C)C)cc1OC.
What is the InChIKey of 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide?
The InChIKey is VYJJKVHKWJBNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O3/c1-8(2)9-5-11(23-4)10(15(22)19-3)6-12(9)24-13-7-20-16(18)21-14(13)17/h5-8H,1-4H3,(H,19,22)(H4,17,18,20,21).
What are the key properties of 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide?
5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide has a molecular weight of 331.38 g/mol, XLogP of 1.92, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-N-methyl-4-propan-2-ylbenzamide is sourced from PubChem (CID 57329522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).