C19H22N4O6S2 — CID 57329965
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate (PubChem CID 57329965) has the molecular formula C19H22N4O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate.
| Compound Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 57329965 |
| Molecular Formula | C19H22N4O6S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN1)C(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C19H22N4O6S2/c1-11(22-17(25)13-7-5-9-20-13)18(26)29-14-8-4-3-6-12(14)16(24)23-19-21-10-15(30-19)31(2,27)28/h3-4,6,8,10-11,13,20H,5,7,9H2,1-2H3,(H,22,25)(H,21,23,24)/t11-,13-/m0/s1 |
| InChIKey | LAWOVVVJVRILRT-AAEUAGOBSA-N |
| XLogP | 0.96 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|