C20H18ClN3O3 — CID 57329994
3-[(2S)-2-[(3-chlorophenyl)-hydroxymethyl]pyrrolidine-1-carbonyl]-1H-quinoxalin-2-one (PubChem CID 57329994) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 3-[(2S)-2-[(3-chlorophenyl)-hydroxymethyl]pyrrolidine-1-carbonyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(2S)-2-[(3-chlorophenyl)-hydroxymethyl]pyrrolidine-1-carbonyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 57329994 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-[(2S)-2-[(3-chlorophenyl)-hydroxymethyl]pyrrolidine-1-carbonyl]-1H-quinoxalin-2-one |
| SMILES | O=C(c1nc2ccccc2[nH]c1=O)N1CCC[C@H]1C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-13-6-3-5-12(11-13)18(25)16-9-4-10-24(16)20(27)17-19(26)23-15-8-2-1-7-14(15)22-17/h1-3,5-8,11,16,18,25H,4,9-10H2,(H,23,26)/t16-,18?/m0/s1 |
| InChIKey | FORQANAYPSMAGB-ATNAJCNCSA-N |
| XLogP | 2.91 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |