C27H42O5 — CID 57330198
(4R,6S,8S,9E,11S,13E,15E,18R)-4,6-dihydroxy-8-methoxy-9,11-dimethyl-18-[(1Z,4E)-2-methylhexa-1,4-dienyl]-1-oxacyclooctadeca-9,13,15-trien-2-one (PubChem CID 57330198) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is (4R,6S,8S,9E,11S,13E,15E,18R)-4,6-dihydroxy-8-methoxy-9,11-dimethyl-18-[(1Z,4E)-2-methylhexa-1,4-dienyl]-1-oxacyclooctadeca-9,13,15-trien-2-one.
| Compound Name | (4R,6S,8S,9E,11S,13E,15E,18R)-4,6-dihydroxy-8-methoxy-9,11-dimethyl-18-[(1Z,4E)-2-methylhexa-1,4-dienyl]-1-oxacyclooctadeca-9,13,15-trien-2-one |
|---|---|
| PubChem CID | 57330198 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (4R,6S,8S,9E,11S,13E,15E,18R)-4,6-dihydroxy-8-methoxy-9,11-dimethyl-18-[(1Z,4E)-2-methylhexa-1,4-dienyl]-1-oxacyclooctadeca-9,13,15-trien-2-one |
| SMILES | C/C=C/C/C(C)=C\[C@H]1C/C=C/C=C/C[C@H](C)/C=C(\C)[C@@H](OC)C[C@@H](O)C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H42O5/c1-6-7-12-21(3)16-25-14-11-9-8-10-13-20(2)15-22(4)26(31-5)18-23(28)17-24(29)19-27(30)32-25/h6-11,15-16,20,23-26,28-29H,12-14,17-19H2,1-5H3/b7-6+,10-8+,11-9+,21-16-,22-15+/t20-,23-,24+,25+,26-/m0/s1 |
| InChIKey | HFNYYLCGJMWNON-UQGXUCOUSA-N |
| XLogP | 5.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|