C22H21ClFNO4S2 — CID 57331107
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 57331107) has the molecular formula C22H21ClFNO4S2 and a molecular weight of 482.00 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 57331107 |
| Molecular Formula | C22H21ClFNO4S2 |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4ccc(F)nc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H21ClFNO4S2/c1-30-22-20(28)18(26)19(27)21(29-22)11-2-5-15(23)13(8-11)9-14-4-6-16(31-14)12-3-7-17(24)25-10-12/h2-8,10,18-22,26-28H,9H2,1H3/t18-,19-,20+,21+,22-/m1/s1 |
| InChIKey | RMIHZGKOPVVREE-LXHROKJGSA-N |
| XLogP | 4.04 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|