C18H26BN3O5 — CID 57331594
(3R,4S)-3-amino-4-(3-boronopropyl)-1-(1,2,3,4-tetrahydroisoquinoline-3-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 57331594) has the molecular formula C18H26BN3O5 and a molecular weight of 375.23 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-(1,2,3,4-tetrahydroisoquinoline-3-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-(1,2,3,4-tetrahydroisoquinoline-3-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57331594 |
| Molecular Formula | C18H26BN3O5 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-(1,2,3,4-tetrahydroisoquinoline-3-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)CN(C(=O)C2Cc3ccccc3CN2)C[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C18H26BN3O5/c20-18(17(24)25)11-22(10-14(18)6-3-7-19(26)27)16(23)15-8-12-4-1-2-5-13(12)9-21-15/h1-2,4-5,14-15,21,26-27H,3,6-11,20H2,(H,24,25)/t14-,15?,18-/m0/s1 |
| InChIKey | WFEBUUXHNXIERH-RARQCXRASA-N |
| XLogP | -0.81 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|