C18H25BF3N3O5 — CID 57331595
(3R,4S)-3-amino-1-[2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 57331595) has the molecular formula C18H25BF3N3O5 and a molecular weight of 431.22 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57331595 |
| Molecular Formula | C18H25BF3N3O5 |
| Molecular Weight | 431.22 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (3R,4S)-3-amino-1-[2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(Cc1ccc(C(F)(F)F)cc1)C(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C18H25BF3N3O5/c20-18(21,22)12-5-3-11(4-6-12)8-14(23)15(26)25-9-13(2-1-7-19(29)30)17(24,10-25)16(27)28/h3-6,13-14,29-30H,1-2,7-10,23-24H2,(H,27,28)/t13-,14?,17-/m0/s1 |
| InChIKey | ZYYDFZULNPOGPQ-PYCCJBKGSA-N |
| XLogP | 0.07 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|