C16H25BN2O4 — CID 57331639
(1S,2S,4S)-1-amino-4-(benzylamino)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid (PubChem CID 57331639) has the molecular formula C16H25BN2O4 and a molecular weight of 320.20 g/mol. Its IUPAC name is (1S,2S,4S)-1-amino-4-(benzylamino)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,4S)-1-amino-4-(benzylamino)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 57331639 |
| Molecular Formula | C16H25BN2O4 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (1S,2S,4S)-1-amino-4-(benzylamino)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C[C@@H](NCc2ccccc2)C[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C16H25BN2O4/c18-16(15(20)21)10-14(9-13(16)7-4-8-17(22)23)19-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,19,22-23H,4,7-11,18H2,(H,20,21)/t13-,14-,16-/m0/s1 |
| InChIKey | OMGMOWXPMOQVJE-DZKIICNBSA-N |
| XLogP | 0.59 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|