C18H28O7 — CID 57331787
methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(hydroxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 57331787) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(hydroxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(hydroxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 57331787 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(hydroxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H](CO)[C@H]3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C18H28O7/c1-21-14(20)9-11-5-6-12-15(22-11)17-16(13(10-19)23-12)24-18(25-17)7-3-2-4-8-18/h11-13,15-17,19H,2-10H2,1H3/t11-,12+,13+,15+,16-,17+/m1/s1 |
| InChIKey | ZMPNTHHUQHMTFB-IJVGXZNQSA-N |
| XLogP | 1.30 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |