C16H16O5 — CID 57331840
(1S,9R,12S,15R,16R)-15-hydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione (PubChem CID 57331840) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (1S,9R,12S,15R,16R)-15-hydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione.
| Compound Name | (1S,9R,12S,15R,16R)-15-hydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione |
|---|---|
| PubChem CID | 57331840 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (1S,9R,12S,15R,16R)-15-hydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione |
| SMILES | C[C@]12C3=CC(=O)OCC3=C[C@H]3OC(=O)[C@@](C)(C=C[C@H]1O)[C@H]32 |
| InChI | InChI=1S/C16H16O5/c1-15-4-3-11(17)16(2)9-6-12(18)20-7-8(9)5-10(13(15)16)21-14(15)19/h3-6,10-11,13,17H,7H2,1-2H3/t10-,11-,13+,15+,16+/m1/s1 |
| InChIKey | JYBNWLHGCZDZAC-VWHJJCLCSA-N |
| XLogP | 0.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|