C21H16FI — CID 57332043
1-fluoro-4-[(E)-1-iodo-3,3-diphenylprop-1-enyl]benzene (PubChem CID 57332043) has the molecular formula C21H16FI and a molecular weight of 414.26 g/mol. Its IUPAC name is 1-fluoro-4-[(E)-1-iodo-3,3-diphenylprop-1-enyl]benzene.
| Compound Name | 1-fluoro-4-[(E)-1-iodo-3,3-diphenylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 57332043 |
| Molecular Formula | C21H16FI |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 1-fluoro-4-[(E)-1-iodo-3,3-diphenylprop-1-enyl]benzene |
| SMILES | Fc1ccc(/C(I)=C\C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16FI/c22-19-13-11-18(12-14-19)21(23)15-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,20H/b21-15+ |
| InChIKey | QEVOLCKYANBEBV-RCCKNPSSSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|