C25H29NO12 — CID 57332451
methyl (2R,3R)-3-acetamido-6-benzoyloxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate (PubChem CID 57332451) has the molecular formula C25H29NO12 and a molecular weight of 535.50 g/mol. Its IUPAC name is methyl (2R,3R)-3-acetamido-6-benzoyloxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3R)-3-acetamido-6-benzoyloxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 57332451 |
| Molecular Formula | C25H29NO12 |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | methyl (2R,3R)-3-acetamido-6-benzoyloxy-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
| SMILES | COC(=O)C1(OC(=O)c2ccccc2)C=C[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C25H29NO12/c1-14(27)26-19-11-12-25(24(32)33-5,38-23(31)18-9-7-6-8-10-18)37-21(19)22(36-17(4)30)20(35-16(3)29)13-34-15(2)28/h6-12,19-22H,13H2,1-5H3,(H,26,27)/t19-,20-,21-,22-,25?/m1/s1 |
| InChIKey | JUHUNLKILSJIDK-KOGKCOTNSA-N |
| XLogP | 0.60 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|