C23H28N2O4 — CID 57333045
methyl (1R,12R,19S)-12-ethyl-5-hydroxy-4-(methoxymethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate (PubChem CID 57333045) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl (1R,12R,19S)-12-ethyl-5-hydroxy-4-(methoxymethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate.
| Compound Name | methyl (1R,12R,19S)-12-ethyl-5-hydroxy-4-(methoxymethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 57333045 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl (1R,12R,19S)-12-ethyl-5-hydroxy-4-(methoxymethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate |
| SMILES | CC[C@]12C=CCN3CC[C@]4(C(=C(C(=O)OC)C1)Nc1cc(O)c(COC)cc14)[C@@H]32 |
| InChI | InChI=1S/C23H28N2O4/c1-4-22-6-5-8-25-9-7-23(21(22)25)16-10-14(13-28-2)18(26)11-17(16)24-19(23)15(12-22)20(27)29-3/h5-6,10-11,21,24,26H,4,7-9,12-13H2,1-3H3/t21-,22-,23-/m0/s1 |
| InChIKey | IXPLJNPLQLSBQR-VABKMULXSA-N |
| XLogP | 3.07 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|