C60H86O20 — CID 57333215
Halichondrin C (PubChem CID 57333215) has the molecular formula C60H86O20 and a molecular weight of 1127.33 g/mol.
| Compound Name | Halichondrin C |
|---|---|
| PubChem CID | 57333215 |
| Molecular Formula | C60H86O20 |
| Molecular Weight | 1127.33 g/mol |
| Exact Mass | 1126.57 |
| IUPAC Name | — |
| SMILES | C=C1C[C@@H]2CC[C@@]34C[C@@]5(O)O[C@H]6[C@@H](O3)[C@H]3O[C@@H](CC[C@@H]3O[C@@H]6[C@@H]5O4)CC(=O)O[C@@H]3[C@H](C)[C@H]4O[C@H]5C[C@]6(C[C@@H]7O[C@@]8(C[C@@H](C)[C@H]7O6)C[C@H](C)[C@@H]6O[C@@H]([C@H](O)C[C@H](O)CO)C[C@H]6O8)O[C@@H]5C[C@@H]4O[C@H]3C[C@H]3O[C@H](CC[C@@H]1O2)C[C@H](C)C3=C |
| InChI | InChI=1S/C60H86O20/c1-26-13-33-7-9-37-27(2)14-35(66-37)11-12-57-25-60(65)56(80-57)55-54(79-60)53(78-57)52-38(70-55)10-8-34(68-52)16-47(64)73-51-31(6)50-43(69-42(51)17-39(67-33)30(26)5)19-41-45(72-50)22-59(74-41)23-46-49(77-59)29(4)21-58(76-46)20-28(3)48-44(75-58)18-40(71-48)36(63)15-32(62)24-61/h26,28-29,31-46,48-56,61-63,65H,2,5,7-25H2,1,3-4,6H3/t26-,28-,29+,31+,32-,33+,34-,35-,36+,37-,38-,39+,40+,41+,42-,43-,44+,45-,46-,48-,49+,50+,51+,52-,53-,54-,55-,56-,57+,58+,59-,60+/m0/s1 |
| InChIKey | YRFGXHUJNOHXQO-JBJWGCMXSA-N |
| XLogP | 4.25 |
| TPSA | 236.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1127.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|