C12H10F4 — CID 57333305
1-(cyclohexen-1-yl)-2,3,4,5-tetrafluorobenzene (PubChem CID 57333305) has the molecular formula C12H10F4 and a molecular weight of 230.20 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-(cyclohexen-1-yl)-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 57333305 |
| Molecular Formula | C12H10F4 |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2,3,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(C2=CCCCC2)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F4/c13-9-6-8(7-4-2-1-3-5-7)10(14)12(16)11(9)15/h4,6H,1-3,5H2 |
| InChIKey | KSMTXIGJYDCSEA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|