C9H10F3N5O3 — CID 57333631
3-nitro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]propan-1-one (PubChem CID 57333631) has the molecular formula C9H10F3N5O3 and a molecular weight of 293.21 g/mol. Its IUPAC name is 3-nitro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]propan-1-one.
| Compound Name | 3-nitro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 57333631 |
| Molecular Formula | C9H10F3N5O3 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-nitro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]propan-1-one |
| SMILES | O=C(CC[N+](=O)[O-])N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F3N5O3/c10-9(11,12)8-14-13-6-5-15(3-4-16(6)8)7(18)1-2-17(19)20/h1-5H2 |
| InChIKey | DSRNTVHMINMQOI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|