About 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol
4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol (PubChem CID 57333708) has the molecular formula C22H20O6
and a molecular weight of 380.40 g/mol. Its IUPAC name is 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol.
Molecular Properties
| Compound Name | 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol |
| PubChem CID | 57333708 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol |
| SMILES | COc1cc2oc3c(OC)c(-c4ccc(O)cc4)cc(OC)c3c2cc1OC |
| InChI | InChI=1S/C22H20O6/c1-24-17-10-15-16(11-18(17)25-2)28-22-20(15)19(26-3)9-14(21(22)27-4)12-5-7-13(23)8-6-12/h5-11,23H,1-4H3 |
| InChIKey | OJQIDWPCCSBILH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol?
The IUPAC name of 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol (CID 57333708) is 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol.
What is the SMILES notation for 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol?
The canonical SMILES for 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol is COc1cc2oc3c(OC)c(-c4ccc(O)cc4)cc(OC)c3c2cc1OC.
What is the InChIKey of 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol?
The InChIKey is OJQIDWPCCSBILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O6/c1-24-17-10-15-16(11-18(17)25-2)28-22-20(15)19(26-3)9-14(21(22)27-4)12-5-7-13(23)8-6-12/h5-11,23H,1-4H3.
What are the key properties of 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol?
4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol has a molecular weight of 380.40 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol is sourced from PubChem (CID 57333708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).