C20H30 — CID 57333715
(1S,3aS,6S,6aR,10aR)-1,4,8-trimethyl-6-(2-methylprop-1-enyl)-1,2,3,3a,6,6a,9,10-octahydrocyclopenta[j]naphthalene (PubChem CID 57333715) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (1S,3aS,6S,6aR,10aR)-1,4,8-trimethyl-6-(2-methylprop-1-enyl)-1,2,3,3a,6,6a,9,10-octahydrocyclopenta[j]naphthalene.
| Compound Name | (1S,3aS,6S,6aR,10aR)-1,4,8-trimethyl-6-(2-methylprop-1-enyl)-1,2,3,3a,6,6a,9,10-octahydrocyclopenta[j]naphthalene |
|---|---|
| PubChem CID | 57333715 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (1S,3aS,6S,6aR,10aR)-1,4,8-trimethyl-6-(2-methylprop-1-enyl)-1,2,3,3a,6,6a,9,10-octahydrocyclopenta[j]naphthalene |
| SMILES | CC(C)=C[C@H]1C=C(C)[C@@H]2CC[C@H](C)[C@@]23CCC(C)=C[C@@H]13 |
| InChI | InChI=1S/C20H30/c1-13(2)10-17-12-15(4)18-7-6-16(5)20(18)9-8-14(3)11-19(17)20/h10-12,16-19H,6-9H2,1-5H3/t16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | GTRREZWKDFADOO-HVTWWXFQSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|