C20H30 — CID 57333716
(3S,3aS,6aS,7S,9aS,9bS)-3,6,9-trimethyl-7-(2-methylprop-1-enyl)-2,3,3a,4,6a,7,9a,9b-octahydro-1H-phenalene (PubChem CID 57333716) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (3S,3aS,6aS,7S,9aS,9bS)-3,6,9-trimethyl-7-(2-methylprop-1-enyl)-2,3,3a,4,6a,7,9a,9b-octahydro-1H-phenalene.
| Compound Name | (3S,3aS,6aS,7S,9aS,9bS)-3,6,9-trimethyl-7-(2-methylprop-1-enyl)-2,3,3a,4,6a,7,9a,9b-octahydro-1H-phenalene |
|---|---|
| PubChem CID | 57333716 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (3S,3aS,6aS,7S,9aS,9bS)-3,6,9-trimethyl-7-(2-methylprop-1-enyl)-2,3,3a,4,6a,7,9a,9b-octahydro-1H-phenalene |
| SMILES | CC(C)=C[C@H]1C=C(C)[C@H]2CC[C@H](C)[C@@H]3CC=C(C)[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C20H30/c1-12(2)10-16-11-15(5)18-8-6-13(3)17-9-7-14(4)19(16)20(17)18/h7,10-11,13,16-20H,6,8-9H2,1-5H3/t13-,16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | KFTGEVGFJUPPJS-YHBMAJSFSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|