About [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol
[3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol (PubChem CID 57334587) has the molecular formula C19H16N2O
and a molecular weight of 288.35 g/mol. Its IUPAC name is [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol |
| PubChem CID | 57334587 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol |
| SMILES | Cc1nccc2c1[nH]c1ccc(-c3cccc(CO)c3)cc12 |
| InChI | InChI=1S/C19H16N2O/c1-12-19-16(7-8-20-12)17-10-15(5-6-18(17)21-19)14-4-2-3-13(9-14)11-22/h2-10,21-22H,11H2,1H3 |
| InChIKey | QCNPRLRLGBJYDQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol?
The IUPAC name of [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol (CID 57334587) is [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol.
What is the SMILES notation for [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol?
The canonical SMILES for [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol is Cc1nccc2c1[nH]c1ccc(-c3cccc(CO)c3)cc12.
What is the InChIKey of [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol?
The InChIKey is QCNPRLRLGBJYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O/c1-12-19-16(7-8-20-12)17-10-15(5-6-18(17)21-19)14-4-2-3-13(9-14)11-22/h2-10,21-22H,11H2,1H3.
What are the key properties of [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol?
[3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol has a molecular weight of 288.35 g/mol, XLogP of 4.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-methyl-9H-pyrido[3,4-b]indol-6-yl)phenyl]methanol is sourced from PubChem (CID 57334587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).