C35H38N10O6 — CID 57334867
4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]propoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 57334867) has the molecular formula C35H38N10O6 and a molecular weight of 694.75 g/mol. Its IUPAC name is 4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]propoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]propoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 57334867 |
| Molecular Formula | C35H38N10O6 |
| Molecular Weight | 694.75 g/mol |
| Exact Mass | 694.30 |
| IUPAC Name | 4-[[4-[3-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]oxy]propoxy]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCCCOc2nc(Nc3ccc(C#N)c(OCC=C(C)C)c3)nc(OC)n2)n1 |
| InChI | InChI=1S/C35H38N10O6/c1-22(2)12-16-48-28-18-26(10-8-24(28)20-36)38-30-40-32(46-5)44-34(42-30)50-14-7-15-51-35-43-31(41-33(45-35)47-6)39-27-11-9-25(21-37)29(19-27)49-17-13-23(3)4/h8-13,18-19H,7,14-17H2,1-6H3,(H,38,40,42,44)(H,39,41,43,45) |
| InChIKey | MCWMVQWUCFRAMQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 204.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.75 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|