C34H60N3+3 — CID 57335116
[3-[[dimethyl(octyl)azaniumyl]methyl]-5-(pyridin-1-ium-1-ylmethyl)phenyl]methyl-dimethyl-octylazanium (PubChem CID 57335116) has the molecular formula C34H60N3+3 and a molecular weight of 510.88 g/mol. Its IUPAC name is [3-[[dimethyl(octyl)azaniumyl]methyl]-5-(pyridin-1-ium-1-ylmethyl)phenyl]methyl-dimethyl-octylazanium.
| Compound Name | [3-[[dimethyl(octyl)azaniumyl]methyl]-5-(pyridin-1-ium-1-ylmethyl)phenyl]methyl-dimethyl-octylazanium |
|---|---|
| PubChem CID | 57335116 |
| Molecular Formula | C34H60N3+3 |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.48 |
| IUPAC Name | [3-[[dimethyl(octyl)azaniumyl]methyl]-5-(pyridin-1-ium-1-ylmethyl)phenyl]methyl-dimethyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(C)Cc1cc(C[n+]2ccccc2)cc(C[N+](C)(C)CCCCCCCC)c1 |
| InChI | InChI=1S/C34H60N3/c1-7-9-11-13-15-20-24-36(3,4)30-33-26-32(29-35-22-18-17-19-23-35)27-34(28-33)31-37(5,6)25-21-16-14-12-10-8-2/h17-19,22-23,26-28H,7-16,20-21,24-25,29-31H2,1-6H3/q+3 |
| InChIKey | ZLXUFEDKMUMMFV-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|